About 9-ethylcarbazol-3-amine
9-ethylcarbazol-3-amine (PubChem CID 8588) has the molecular formula C14H14N2
and a molecular weight of 210.28 g/mol. Its IUPAC name is 9-ethylcarbazol-3-amine.
Molecular Properties
| Compound Name | 9-ethylcarbazol-3-amine |
| PubChem CID | 8588 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 9-ethylcarbazol-3-amine |
| SMILES | CCn1c2ccccc2c2cc(N)ccc21 |
| InChI | InChI=1S/C14H14N2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9H,2,15H2,1H3 |
| InChIKey | OXEUETBFKVCRNP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 9-ethylcarbazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-ethylcarbazol-3-amine?
The IUPAC name of 9-ethylcarbazol-3-amine (CID 8588) is 9-ethylcarbazol-3-amine.
What is the SMILES notation for 9-ethylcarbazol-3-amine?
The canonical SMILES for 9-ethylcarbazol-3-amine is CCn1c2ccccc2c2cc(N)ccc21.
What is the InChIKey of 9-ethylcarbazol-3-amine?
The InChIKey is OXEUETBFKVCRNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14N2/c1-2-16-13-6-4-3-5-11(13)12-9-10(15)7-8-14(12)16/h3-9H,2,15H2,1H3.
What are the key properties of 9-ethylcarbazol-3-amine?
9-ethylcarbazol-3-amine has a molecular weight of 210.28 g/mol, XLogP of 3.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-ethylcarbazol-3-amine is sourced from PubChem (CID 8588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).