C15H19N — CID 143016704
2,3-dimethyl-1H-indole;(3Z)-penta-1,3-diene (PubChem CID 143016704) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2,3-dimethyl-1H-indole;(3Z)-penta-1,3-diene.
| Compound Name | 2,3-dimethyl-1H-indole;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 143016704 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2,3-dimethyl-1H-indole;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.Cc1[nH]c2ccccc2c1C |
| InChI | InChI=1S/C10H11N.C5H8/c1-7-8(2)11-10-6-4-3-5-9(7)10;1-3-5-4-2/h3-6,11H,1-2H3;3-5H,1H2,2H3/b;5-4- |
| InChIKey | QDUBFAFSXIDSIX-GUHKXDMSSA-N |
| XLogP | 4.53 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|