About 2,3-dimethyl-1H-indole;ethane;1H-pyrrole
2,3-dimethyl-1H-indole;ethane;1H-pyrrole (PubChem CID 159131567) has the molecular formula C22H40N2
and a molecular weight of 332.58 g/mol. Its IUPAC name is 2,3-dimethyl-1H-indole;ethane;1H-pyrrole.
Molecular Properties
| Compound Name | 2,3-dimethyl-1H-indole;ethane;1H-pyrrole |
| PubChem CID | 159131567 |
| Molecular Formula | C22H40N2 |
| Molecular Weight | 332.58 g/mol |
| Exact Mass | 332.32 |
| IUPAC Name | 2,3-dimethyl-1H-indole;ethane;1H-pyrrole |
| SMILES | CC.CC.CC.CC.Cc1[nH]c2ccccc2c1C.c1cc[nH]c1 |
| InChI | InChI=1S/C10H11N.C4H5N.4C2H6/c1-7-8(2)11-10-6-4-3-5-9(7)10;1-2-4-5-3-1;4*1-2/h3-6,11H,1-2H3;1-5H;4*1-2H3 |
| InChIKey | KGYQKNPQQVINAI-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 31.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 332.58 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-1H-indole;ethane;1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-1H-indole;ethane;1H-pyrrole?
The IUPAC name of 2,3-dimethyl-1H-indole;ethane;1H-pyrrole (CID 159131567) is 2,3-dimethyl-1H-indole;ethane;1H-pyrrole.
What is the SMILES notation for 2,3-dimethyl-1H-indole;ethane;1H-pyrrole?
The canonical SMILES for 2,3-dimethyl-1H-indole;ethane;1H-pyrrole is CC.CC.CC.CC.Cc1[nH]c2ccccc2c1C.c1cc[nH]c1.
What is the InChIKey of 2,3-dimethyl-1H-indole;ethane;1H-pyrrole?
The InChIKey is KGYQKNPQQVINAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C4H5N.4C2H6/c1-7-8(2)11-10-6-4-3-5-9(7)10;1-2-4-5-3-1;4*1-2/h3-6,11H,1-2H3;1-5H;4*1-2H3.
What are the key properties of 2,3-dimethyl-1H-indole;ethane;1H-pyrrole?
2,3-dimethyl-1H-indole;ethane;1H-pyrrole has a molecular weight of 332.58 g/mol, XLogP of 7.90, 0 rotatable bonds, 2 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-1H-indole;ethane;1H-pyrrole is sourced from PubChem (CID 159131567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).