C12H16N2 — CID 119082195
N,N-dimethyl-1-(3-methyl-1H-indol-2-yl)methanamine (PubChem CID 119082195) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is N,N-dimethyl-1-(3-methyl-1H-indol-2-yl)methanamine.
| Compound Name | N,N-dimethyl-1-(3-methyl-1H-indol-2-yl)methanamine |
|---|---|
| PubChem CID | 119082195 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | N,N-dimethyl-1-(3-methyl-1H-indol-2-yl)methanamine |
| SMILES | Cc1c(CN(C)C)[nH]c2ccccc12 |
| InChI | InChI=1S/C12H16N2/c1-9-10-6-4-5-7-11(10)13-12(9)8-14(2)3/h4-7,13H,8H2,1-3H3 |
| InChIKey | COSLMFQLEJRIML-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|