C18H14N2O2 — CID 11623432
2-[(3-methyl-1H-indol-2-yl)methyl]isoindole-1,3-dione (PubChem CID 11623432) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 2-[(3-methyl-1H-indol-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 2-[(3-methyl-1H-indol-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 11623432 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-[(3-methyl-1H-indol-2-yl)methyl]isoindole-1,3-dione |
| SMILES | Cc1c(CN2C(=O)c3ccccc3C2=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H14N2O2/c1-11-12-6-4-5-9-15(12)19-16(11)10-20-17(21)13-7-2-3-8-14(13)18(20)22/h2-9,19H,10H2,1H3 |
| InChIKey | AFYMGEZNWFZMPW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|