C18H23N3O2 — CID 130265212
3-methyl-4-[(3-methyl-1H-indol-2-yl)methyl]-1-propylpiperazine-2,5-dione (PubChem CID 130265212) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 3-methyl-4-[(3-methyl-1H-indol-2-yl)methyl]-1-propylpiperazine-2,5-dione.
| Compound Name | 3-methyl-4-[(3-methyl-1H-indol-2-yl)methyl]-1-propylpiperazine-2,5-dione |
|---|---|
| PubChem CID | 130265212 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 3-methyl-4-[(3-methyl-1H-indol-2-yl)methyl]-1-propylpiperazine-2,5-dione |
| SMILES | CCCN1CC(=O)N(Cc2[nH]c3ccccc3c2C)C(C)C1=O |
| InChI | InChI=1S/C18H23N3O2/c1-4-9-20-11-17(22)21(13(3)18(20)23)10-16-12(2)14-7-5-6-8-15(14)19-16/h5-8,13,19H,4,9-11H2,1-3H3 |
| InChIKey | QVDNCFPIUQFJQT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|