C26H20N2O4 — CID 5094148
2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethylphenyl]methyl]isoindole-1,3-dione (PubChem CID 5094148) has the molecular formula C26H20N2O4 and a molecular weight of 424.46 g/mol. Its IUPAC name is 2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethylphenyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethylphenyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 5094148 |
| Molecular Formula | C26H20N2O4 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[[5-[(1,3-dioxoisoindol-2-yl)methyl]-2,4-dimethylphenyl]methyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C)c(CN2C(=O)c3ccccc3C2=O)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H20N2O4/c1-15-11-16(2)18(14-28-25(31)21-9-5-6-10-22(21)26(28)32)12-17(15)13-27-23(29)19-7-3-4-8-20(19)24(27)30/h3-12H,13-14H2,1-2H3 |
| InChIKey | FGERNCPVMGHGBV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|