C17H11BrN2O2 — CID 10641894
2-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylbenzonitrile (PubChem CID 10641894) has the molecular formula C17H11BrN2O2 and a molecular weight of 355.19 g/mol. Its IUPAC name is 2-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylbenzonitrile.
| Compound Name | 2-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylbenzonitrile |
|---|---|
| PubChem CID | 10641894 |
| Molecular Formula | C17H11BrN2O2 |
| Molecular Weight | 355.19 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 2-bromo-5-[(1,3-dioxoisoindol-2-yl)methyl]-4-methylbenzonitrile |
| SMILES | Cc1cc(Br)c(C#N)cc1CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H11BrN2O2/c1-10-6-15(18)11(8-19)7-12(10)9-20-16(21)13-4-2-3-5-14(13)17(20)22/h2-7H,9H2,1H3 |
| InChIKey | WJTHZFBDFSIUQP-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|