C17H12N2O2 — CID 168518990
5-(1,3-dioxoisoindol-2-yl)-2,4-dimethylbenzonitrile (PubChem CID 168518990) has the molecular formula C17H12N2O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 5-(1,3-dioxoisoindol-2-yl)-2,4-dimethylbenzonitrile.
| Compound Name | 5-(1,3-dioxoisoindol-2-yl)-2,4-dimethylbenzonitrile |
|---|---|
| PubChem CID | 168518990 |
| Molecular Formula | C17H12N2O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-(1,3-dioxoisoindol-2-yl)-2,4-dimethylbenzonitrile |
| SMILES | Cc1cc(C)c(N2C(=O)c3ccccc3C2=O)cc1C#N |
| InChI | InChI=1S/C17H12N2O2/c1-10-7-11(2)15(8-12(10)9-18)19-16(20)13-5-3-4-6-14(13)17(19)21/h3-8H,1-2H3 |
| InChIKey | YTZOMERNSDPMCC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|