C15H6ClIN2O2 — CID 168519216
2-chloro-4-(1,3-dioxoisoindol-2-yl)-5-iodobenzonitrile (PubChem CID 168519216) has the molecular formula C15H6ClIN2O2 and a molecular weight of 408.58 g/mol. Its IUPAC name is 2-chloro-4-(1,3-dioxoisoindol-2-yl)-5-iodobenzonitrile.
| Compound Name | 2-chloro-4-(1,3-dioxoisoindol-2-yl)-5-iodobenzonitrile |
|---|---|
| PubChem CID | 168519216 |
| Molecular Formula | C15H6ClIN2O2 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 407.92 |
| IUPAC Name | 2-chloro-4-(1,3-dioxoisoindol-2-yl)-5-iodobenzonitrile |
| SMILES | N#Cc1cc(I)c(N2C(=O)c3ccccc3C2=O)cc1Cl |
| InChI | InChI=1S/C15H6ClIN2O2/c16-11-6-13(12(17)5-8(11)7-18)19-14(20)9-3-1-2-4-10(9)15(19)21/h1-6H |
| InChIKey | OJZJBLGFIZAIIU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|