[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid

C14H8BCl2NO4 — CID 168517976

IUPAC[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid
SMILESO=C1c2ccccc2C(=O)N1c1cc(B(O)O)c(Cl)cc1Cl
InChIInChI=1S/C14H8BCl2NO4/c16-10-6-11(17)12(5-9(10)15(21)22)18-13(19)7-3-1-2-4-8(7)14(18)20/h1-6,21-22H
InChIKeyICYQCGBUADHYJT-UHFFFAOYSA-N
MW335.94 g/mol
LogP1.47
Rot. Bonds2

About [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid

[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid (PubChem CID 168517976) has the molecular formula C14H8BCl2NO4 and a molecular weight of 335.94 g/mol. Its IUPAC name is [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid.

Molecular Properties

Compound Name[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid
PubChem CID168517976
Molecular FormulaC14H8BCl2NO4
Molecular Weight335.94 g/mol
Exact Mass334.99
IUPAC Name[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid
SMILESO=C1c2ccccc2C(=O)N1c1cc(B(O)O)c(Cl)cc1Cl
InChIInChI=1S/C14H8BCl2NO4/c16-10-6-11(17)12(5-9(10)15(21)22)18-13(19)7-3-1-2-4-8(7)14(18)20/h1-6,21-22H
InChIKeyICYQCGBUADHYJT-UHFFFAOYSA-N
XLogP1.47
TPSA77.84 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms22
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500335.94
LogP ≤ 51.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid?
The IUPAC name of [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid (CID 168517976) is [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid.
What is the SMILES notation for [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid?
The canonical SMILES for [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid is O=C1c2ccccc2C(=O)N1c1cc(B(O)O)c(Cl)cc1Cl.
What is the InChIKey of [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid?
The InChIKey is ICYQCGBUADHYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8BCl2NO4/c16-10-6-11(17)12(5-9(10)15(21)22)18-13(19)7-3-1-2-4-8(7)14(18)20/h1-6,21-22H.
What are the key properties of [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid?
[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid has a molecular weight of 335.94 g/mol, XLogP of 1.47, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid is sourced from PubChem (CID 168517976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).