C14H8BCl2NO4 — CID 168517976
[2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid (PubChem CID 168517976) has the molecular formula C14H8BCl2NO4 and a molecular weight of 335.94 g/mol. Its IUPAC name is [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid.
| Compound Name | [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 168517976 |
| Molecular Formula | C14H8BCl2NO4 |
| Molecular Weight | 335.94 g/mol |
| Exact Mass | 334.99 |
| IUPAC Name | [2,4-dichloro-5-(1,3-dioxoisoindol-2-yl)phenyl]boronic acid |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(B(O)O)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H8BCl2NO4/c16-10-6-11(17)12(5-9(10)15(21)22)18-13(19)7-3-1-2-4-8(7)14(18)20/h1-6,21-22H |
| InChIKey | ICYQCGBUADHYJT-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.94 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|