C14H9ClN2O4S — CID 168519429
4-chloro-3-(1,3-dioxoisoindol-2-yl)benzenesulfonamide (PubChem CID 168519429) has the molecular formula C14H9ClN2O4S and a molecular weight of 336.76 g/mol. Its IUPAC name is 4-chloro-3-(1,3-dioxoisoindol-2-yl)benzenesulfonamide.
| Compound Name | 4-chloro-3-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 168519429 |
| Molecular Formula | C14H9ClN2O4S |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.00 |
| IUPAC Name | 4-chloro-3-(1,3-dioxoisoindol-2-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1ccc(Cl)c(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C14H9ClN2O4S/c15-11-6-5-8(22(16,20)21)7-12(11)17-13(18)9-3-1-2-4-10(9)14(17)19/h1-7H,(H2,16,20,21) |
| InChIKey | OWYQHLMUONMOOJ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|