C15H10BrNO5S — CID 118467727
2-(3-bromo-2-hydroxy-5-methylsulfonylphenyl)isoindole-1,3-dione (PubChem CID 118467727) has the molecular formula C15H10BrNO5S and a molecular weight of 396.22 g/mol. Its IUPAC name is 2-(3-bromo-2-hydroxy-5-methylsulfonylphenyl)isoindole-1,3-dione.
| Compound Name | 2-(3-bromo-2-hydroxy-5-methylsulfonylphenyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 118467727 |
| Molecular Formula | C15H10BrNO5S |
| Molecular Weight | 396.22 g/mol |
| Exact Mass | 394.95 |
| IUPAC Name | 2-(3-bromo-2-hydroxy-5-methylsulfonylphenyl)isoindole-1,3-dione |
| SMILES | CS(=O)(=O)c1cc(Br)c(O)c(N2C(=O)c3ccccc3C2=O)c1 |
| InChI | InChI=1S/C15H10BrNO5S/c1-23(21,22)8-6-11(16)13(18)12(7-8)17-14(19)9-4-2-3-5-10(9)15(17)20/h2-7,18H,1H3 |
| InChIKey | AKUGOYZFELBUFH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|