C20H13NO8S2 — CID 168518696
4-(benzenesulfonyloxy)-3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid (PubChem CID 168518696) has the molecular formula C20H13NO8S2 and a molecular weight of 459.46 g/mol. Its IUPAC name is 4-(benzenesulfonyloxy)-3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid.
| Compound Name | 4-(benzenesulfonyloxy)-3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid |
|---|---|
| PubChem CID | 168518696 |
| Molecular Formula | C20H13NO8S2 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.01 |
| IUPAC Name | 4-(benzenesulfonyloxy)-3-(1,3-dioxoisoindol-2-yl)benzenesulfonic acid |
| SMILES | O=C1c2ccccc2C(=O)N1c1cc(S(=O)(=O)O)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H13NO8S2/c22-19-15-8-4-5-9-16(15)20(23)21(19)17-12-14(30(24,25)26)10-11-18(17)29-31(27,28)13-6-2-1-3-7-13/h1-12H,(H,24,25,26) |
| InChIKey | WRIYILLZDGYKMT-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|