C21H15N3O9S2 — CID 168518667
3-(1,3-dioxoisoindol-2-yl)-4-methyl-5-[(3-nitrophenyl)sulfonylamino]benzenesulfonic acid (PubChem CID 168518667) has the molecular formula C21H15N3O9S2 and a molecular weight of 517.50 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-4-methyl-5-[(3-nitrophenyl)sulfonylamino]benzenesulfonic acid.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-4-methyl-5-[(3-nitrophenyl)sulfonylamino]benzenesulfonic acid |
|---|---|
| PubChem CID | 168518667 |
| Molecular Formula | C21H15N3O9S2 |
| Molecular Weight | 517.50 g/mol |
| Exact Mass | 517.02 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-4-methyl-5-[(3-nitrophenyl)sulfonylamino]benzenesulfonic acid |
| SMILES | Cc1c(NS(=O)(=O)c2cccc([N+](=O)[O-])c2)cc(S(=O)(=O)O)cc1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C21H15N3O9S2/c1-12-18(22-34(29,30)14-6-4-5-13(9-14)24(27)28)10-15(35(31,32)33)11-19(12)23-20(25)16-7-2-3-8-17(16)21(23)26/h2-11,22H,1H3,(H,31,32,33) |
| InChIKey | QKNYEJIOKUFTNF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 181.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|