C21H14FN3O4S2 — CID 90626956
N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-3-nitrobenzenesulfonamide (PubChem CID 90626956) has the molecular formula C21H14FN3O4S2 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 90626956 |
| Molecular Formula | C21H14FN3O4S2 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.04 |
| IUPAC Name | N-[2-[2-(2-fluorophenyl)-1,3-thiazol-4-yl]phenyl]-3-nitrobenzenesulfonamide |
| SMILES | O=[N+]([O-])c1cccc(S(=O)(=O)Nc2ccccc2-c2csc(-c3ccccc3F)n2)c1 |
| InChI | InChI=1S/C21H14FN3O4S2/c22-18-10-3-1-8-16(18)21-23-20(13-30-21)17-9-2-4-11-19(17)24-31(28,29)15-7-5-6-14(12-15)25(26)27/h1-13,24H |
| InChIKey | FIWYGGBEJWGWSN-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|