C20H15FN4O6S — CID 55362792
N-[2-[[(2-fluorobenzoyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide (PubChem CID 55362792) has the molecular formula C20H15FN4O6S and a molecular weight of 458.43 g/mol. Its IUPAC name is N-[2-[[(2-fluorobenzoyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide.
| Compound Name | N-[2-[[(2-fluorobenzoyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55362792 |
| Molecular Formula | C20H15FN4O6S |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.07 |
| IUPAC Name | N-[2-[[(2-fluorobenzoyl)amino]carbamoyl]phenyl]-3-nitrobenzenesulfonamide |
| SMILES | O=C(NNC(=O)c1ccccc1NS(=O)(=O)c1cccc([N+](=O)[O-])c1)c1ccccc1F |
| InChI | InChI=1S/C20H15FN4O6S/c21-17-10-3-1-8-15(17)19(26)22-23-20(27)16-9-2-4-11-18(16)24-32(30,31)14-7-5-6-13(12-14)25(28)29/h1-12,24H,(H,22,26)(H,23,27) |
| InChIKey | GFJYAOSZKIPLPM-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 147.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|