C17H15N7O6S — CID 55443815
(4,6-diamino-1,3,5-triazin-2-yl)methyl 2-[(3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 55443815) has the molecular formula C17H15N7O6S and a molecular weight of 445.42 g/mol. Its IUPAC name is (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-[(3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-[(3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 55443815 |
| Molecular Formula | C17H15N7O6S |
| Molecular Weight | 445.42 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (4,6-diamino-1,3,5-triazin-2-yl)methyl 2-[(3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | Nc1nc(N)nc(COC(=O)c2ccccc2NS(=O)(=O)c2cccc([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C17H15N7O6S/c18-16-20-14(21-17(19)22-16)9-30-15(25)12-6-1-2-7-13(12)23-31(28,29)11-5-3-4-10(8-11)24(26)27/h1-8,23H,9H2,(H4,18,19,20,21,22) |
| InChIKey | IARTVUDIESJYDO-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 206.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|