C21H19N3O7S2 — CID 34137926
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate (PubChem CID 34137926) has the molecular formula C21H19N3O7S2 and a molecular weight of 489.53 g/mol. Its IUPAC name is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate.
| Compound Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 34137926 |
| Molecular Formula | C21H19N3O7S2 |
| Molecular Weight | 489.53 g/mol |
| Exact Mass | 489.07 |
| IUPAC Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-[(3-nitrophenyl)sulfonylamino]benzoate |
| SMILES | CN(Cc1ccsc1)C(=O)COC(=O)c1ccccc1NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H19N3O7S2/c1-23(12-15-9-10-32-14-15)20(25)13-31-21(26)18-7-2-3-8-19(18)22-33(29,30)17-6-4-5-16(11-17)24(27)28/h2-11,14,22H,12-13H2,1H3 |
| InChIKey | XQKUHWVPVLPIDY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 135.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|