About [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate (PubChem CID 9231185) has the molecular formula C23H19NO3S
and a molecular weight of 389.48 g/mol. Its IUPAC name is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate.
Molecular Properties
| Compound Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate |
| PubChem CID | 9231185 |
| Molecular Formula | C23H19NO3S |
| Molecular Weight | 389.48 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate |
| SMILES | CN(Cc1ccsc1)C(=O)COC(=O)c1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C23H19NO3S/c1-24(13-16-10-11-28-15-16)21(25)14-27-23(26)22-19-8-4-2-6-17(19)12-18-7-3-5-9-20(18)22/h2-12,15H,13-14H2,1H3 |
| InChIKey | WKRYMEFZUGEZRV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate?
The IUPAC name of [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate (CID 9231185) is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate.
What is the SMILES notation for [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate?
The canonical SMILES for [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate is CN(Cc1ccsc1)C(=O)COC(=O)c1c2ccccc2cc2ccccc12.
What is the InChIKey of [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate?
The InChIKey is WKRYMEFZUGEZRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19NO3S/c1-24(13-16-10-11-28-15-16)21(25)14-27-23(26)22-19-8-4-2-6-17(19)12-18-7-3-5-9-20(18)22/h2-12,15H,13-14H2,1H3.
What are the key properties of [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate?
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate has a molecular weight of 389.48 g/mol, XLogP of 4.87, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] anthracene-9-carboxylate is sourced from PubChem (CID 9231185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).