C20H17NO4S2 — CID 18202620
[2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-(thiophene-2-carbonyl)benzoate (PubChem CID 18202620) has the molecular formula C20H17NO4S2 and a molecular weight of 399.49 g/mol. Its IUPAC name is [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 18202620 |
| Molecular Formula | C20H17NO4S2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | [2-[methyl(thiophen-3-ylmethyl)amino]-2-oxoethyl] 2-(thiophene-2-carbonyl)benzoate |
| SMILES | CN(Cc1ccsc1)C(=O)COC(=O)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C20H17NO4S2/c1-21(11-14-8-10-26-13-14)18(22)12-25-20(24)16-6-3-2-5-15(16)19(23)17-7-4-9-27-17/h2-10,13H,11-12H2,1H3 |
| InChIKey | BCGJCQSPMPQSOO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |