C15H12O5S — CID 18151557
(2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate (PubChem CID 18151557) has the molecular formula C15H12O5S and a molecular weight of 304.32 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 18151557 |
| Molecular Formula | C15H12O5S |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate |
| SMILES | COC(=O)COC(=O)c1ccccc1C(=O)c1cccs1 |
| InChI | InChI=1S/C15H12O5S/c1-19-13(16)9-20-15(18)11-6-3-2-5-10(11)14(17)12-7-4-8-21-12/h2-8H,9H2,1H3 |
| InChIKey | DNQBGEFRFDUSQY-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |