(2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate

C15H12O5S — CID 18151557

IUPAC(2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate
SMILESCOC(=O)COC(=O)c1ccccc1C(=O)c1cccs1
InChIInChI=1S/C15H12O5S/c1-19-13(16)9-20-15(18)11-6-3-2-5-10(11)14(17)12-7-4-8-21-12/h2-8H,9H2,1H3
InChIKeyDNQBGEFRFDUSQY-UHFFFAOYSA-N
MW304.32 g/mol
LogP2.31
Rot. Bonds5

About (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate

(2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate (PubChem CID 18151557) has the molecular formula C15H12O5S and a molecular weight of 304.32 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate.

Molecular Properties

Compound Name(2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate
PubChem CID18151557
Molecular FormulaC15H12O5S
Molecular Weight304.32 g/mol
Exact Mass304.04
IUPAC Name(2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate
SMILESCOC(=O)COC(=O)c1ccccc1C(=O)c1cccs1
InChIInChI=1S/C15H12O5S/c1-19-13(16)9-20-15(18)11-6-3-2-5-10(11)14(17)12-7-4-8-21-12/h2-8H,9H2,1H3
InChIKeyDNQBGEFRFDUSQY-UHFFFAOYSA-N
XLogP2.31
TPSA69.67 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500304.32
LogP ≤ 52.31
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate?
The IUPAC name of (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate (CID 18151557) is (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate.
What is the SMILES notation for (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate?
The canonical SMILES for (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate is COC(=O)COC(=O)c1ccccc1C(=O)c1cccs1.
What is the InChIKey of (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate?
The InChIKey is DNQBGEFRFDUSQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12O5S/c1-19-13(16)9-20-15(18)11-6-3-2-5-10(11)14(17)12-7-4-8-21-12/h2-8H,9H2,1H3.
What are the key properties of (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate?
(2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate has a molecular weight of 304.32 g/mol, XLogP of 2.31, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methoxy-2-oxoethyl) 2-(thiophene-2-carbonyl)benzoate is sourced from PubChem (CID 18151557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).