C21H18N2O5S2 — CID 55386197
[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 2-(thiophene-2-carbonyl)benzoate (PubChem CID 55386197) has the molecular formula C21H18N2O5S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 2-(thiophene-2-carbonyl)benzoate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 2-(thiophene-2-carbonyl)benzoate |
|---|---|
| PubChem CID | 55386197 |
| Molecular Formula | C21H18N2O5S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 2-(thiophene-2-carbonyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1C(=O)c1cccs1)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C21H18N2O5S2/c24-18(23-21(27)22-10-9-14-5-3-11-29-14)13-28-20(26)16-7-2-1-6-15(16)19(25)17-8-4-12-30-17/h1-8,11-12H,9-10,13H2,(H2,22,23,24,27) |
| InChIKey | IHNXAKUGQVRJBZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |