C14H15N3O6S3 — CID 24531108
[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 24531108) has the molecular formula C14H15N3O6S3 and a molecular weight of 417.49 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 24531108 |
| Molecular Formula | C14H15N3O6S3 |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.01 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | NS(=O)(=O)c1cc(C(=O)OCC(=O)NC(=O)NCCc2cccs2)cs1 |
| InChI | InChI=1S/C14H15N3O6S3/c15-26(21,22)12-6-9(8-25-12)13(19)23-7-11(18)17-14(20)16-4-3-10-2-1-5-24-10/h1-2,5-6,8H,3-4,7H2,(H2,15,21,22)(H2,16,17,18,20) |
| InChIKey | RCPOCCCVDVEEQW-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |