C19H19N3O8S — CID 33328996
1-O-ethyl 3-O-[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-nitrobenzene-1,3-dicarboxylate (PubChem CID 33328996) has the molecular formula C19H19N3O8S and a molecular weight of 449.44 g/mol. Its IUPAC name is 1-O-ethyl 3-O-[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-nitrobenzene-1,3-dicarboxylate.
| Compound Name | 1-O-ethyl 3-O-[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 33328996 |
| Molecular Formula | C19H19N3O8S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 1-O-ethyl 3-O-[2-oxo-2-(2-thiophen-2-ylethylcarbamoylamino)ethyl] 5-nitrobenzene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1cc(C(=O)OCC(=O)NC(=O)NCCc2cccs2)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H19N3O8S/c1-2-29-17(24)12-8-13(10-14(9-12)22(27)28)18(25)30-11-16(23)21-19(26)20-6-5-15-4-3-7-31-15/h3-4,7-10H,2,5-6,11H2,1H3,(H2,20,21,23,26) |
| InChIKey | MOBQWNXIVCQHEN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|