C16H15N3O8S2 — CID 27028526
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate (PubChem CID 27028526) has the molecular formula C16H15N3O8S2 and a molecular weight of 441.44 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 27028526 |
| Molecular Formula | C16H15N3O8S2 |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.03 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-methylsulfonyl-3-nitrobenzoate |
| SMILES | CS(=O)(=O)c1ccc(C(=O)OCC(=O)NC(=O)NCc2cccs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H15N3O8S2/c1-29(25,26)13-5-4-10(7-12(13)19(23)24)15(21)27-9-14(20)18-16(22)17-8-11-3-2-6-28-11/h2-7H,8-9H2,1H3,(H2,17,18,20,22) |
| InChIKey | RHMIXZRRWDGCDE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 161.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|