C16H15ClN2O6S2 — CID 27270268
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-chloro-3-methylsulfonylbenzoate (PubChem CID 27270268) has the molecular formula C16H15ClN2O6S2 and a molecular weight of 430.89 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-chloro-3-methylsulfonylbenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-chloro-3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 27270268 |
| Molecular Formula | C16H15ClN2O6S2 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.01 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 4-chloro-3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cc(C(=O)OCC(=O)NC(=O)NCc2cccs2)ccc1Cl |
| InChI | InChI=1S/C16H15ClN2O6S2/c1-27(23,24)13-7-10(4-5-12(13)17)15(21)25-9-14(20)19-16(22)18-8-11-3-2-6-26-11/h2-7H,8-9H2,1H3,(H2,18,19,20,22) |
| InChIKey | QWRNLSZNUAAZTC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |