C15H12Cl2N2O4S — CID 27213023
[2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2,3-dichlorobenzoate (PubChem CID 27213023) has the molecular formula C15H12Cl2N2O4S and a molecular weight of 387.24 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2,3-dichlorobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2,3-dichlorobenzoate |
|---|---|
| PubChem CID | 27213023 |
| Molecular Formula | C15H12Cl2N2O4S |
| Molecular Weight | 387.24 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylcarbamoylamino)ethyl] 2,3-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1cccc(Cl)c1Cl)NC(=O)NCc1cccs1 |
| InChI | InChI=1S/C15H12Cl2N2O4S/c16-11-5-1-4-10(13(11)17)14(21)23-8-12(20)19-15(22)18-7-9-3-2-6-24-9/h1-6H,7-8H2,(H2,18,19,20,22) |
| InChIKey | CJDSHXQKMXBSSM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.24 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |