C14H10Cl3NO3S — CID 2578669
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,6-trichlorobenzoate (PubChem CID 2578669) has the molecular formula C14H10Cl3NO3S and a molecular weight of 378.66 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,6-trichlorobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,6-trichlorobenzoate |
|---|---|
| PubChem CID | 2578669 |
| Molecular Formula | C14H10Cl3NO3S |
| Molecular Weight | 378.66 g/mol |
| Exact Mass | 376.94 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,3,6-trichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)ccc(Cl)c1Cl)NCc1cccs1 |
| InChI | InChI=1S/C14H10Cl3NO3S/c15-9-3-4-10(16)13(17)12(9)14(20)21-7-11(19)18-6-8-2-1-5-22-8/h1-5H,6-7H2,(H,18,19) |
| InChIKey | LGWCKPLUROKIHG-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|