C14H11Cl2NO3S — CID 2364548
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate (PubChem CID 2364548) has the molecular formula C14H11Cl2NO3S and a molecular weight of 344.22 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 2364548 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)NCc1cccs1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c15-10-4-1-5-11(16)13(10)14(19)20-8-12(18)17-7-9-3-2-6-21-9/h1-6H,7-8H2,(H,17,18) |
| InChIKey | SVCCAEABIRPOCL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |