About [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate (PubChem CID 2364548) has the molecular formula C14H11Cl2NO3S
and a molecular weight of 344.22 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate.
Molecular Properties
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate |
| PubChem CID | 2364548 |
| Molecular Formula | C14H11Cl2NO3S |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate |
| SMILES | O=C(COC(=O)c1c(Cl)cccc1Cl)NCc1cccs1 |
| InChI | InChI=1S/C14H11Cl2NO3S/c15-10-4-1-5-11(16)13(10)14(19)20-8-12(18)17-7-9-3-2-6-21-9/h1-6H,7-8H2,(H,17,18) |
| InChIKey | SVCCAEABIRPOCL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate?
The IUPAC name of [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate (CID 2364548) is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate.
What is the SMILES notation for [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate?
The canonical SMILES for [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate is O=C(COC(=O)c1c(Cl)cccc1Cl)NCc1cccs1.
What is the InChIKey of [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate?
The InChIKey is SVCCAEABIRPOCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11Cl2NO3S/c15-10-4-1-5-11(16)13(10)14(19)20-8-12(18)17-7-9-3-2-6-21-9/h1-6H,7-8H2,(H,17,18).
What are the key properties of [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate?
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate has a molecular weight of 344.22 g/mol, XLogP of 3.53, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2,6-dichlorobenzoate is sourced from PubChem (CID 2364548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).