C14H10ClF2NO3S — CID 2364701
[2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-chloro-4,5-difluorobenzoate (PubChem CID 2364701) has the molecular formula C14H10ClF2NO3S and a molecular weight of 345.75 g/mol. Its IUPAC name is [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-chloro-4,5-difluorobenzoate.
| Compound Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-chloro-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 2364701 |
| Molecular Formula | C14H10ClF2NO3S |
| Molecular Weight | 345.75 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | [2-oxo-2-(thiophen-2-ylmethylamino)ethyl] 2-chloro-4,5-difluorobenzoate |
| SMILES | O=C(COC(=O)c1cc(F)c(F)cc1Cl)NCc1cccs1 |
| InChI | InChI=1S/C14H10ClF2NO3S/c15-10-5-12(17)11(16)4-9(10)14(20)21-7-13(19)18-6-8-2-1-3-22-8/h1-5H,6-7H2,(H,18,19) |
| InChIKey | DBKZLZRTXZNJPU-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.75 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|