C15H12Cl2FNO3S — CID 8958733
[(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2,4-dichloro-5-fluorobenzoate (PubChem CID 8958733) has the molecular formula C15H12Cl2FNO3S and a molecular weight of 376.24 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2,4-dichloro-5-fluorobenzoate.
| Compound Name | [(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2,4-dichloro-5-fluorobenzoate |
|---|---|
| PubChem CID | 8958733 |
| Molecular Formula | C15H12Cl2FNO3S |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | [(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2,4-dichloro-5-fluorobenzoate |
| SMILES | C[C@H](OC(=O)c1cc(F)c(Cl)cc1Cl)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C15H12Cl2FNO3S/c1-8(14(20)19-7-9-3-2-4-23-9)22-15(21)10-5-13(18)12(17)6-11(10)16/h2-6,8H,7H2,1H3,(H,19,20)/t8-/m0/s1 |
| InChIKey | VUPNJBZMDDLDGK-QMMMGPOBSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|