C13H13NO4S — CID 651235
[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] furan-2-carboxylate (PubChem CID 651235) has the molecular formula C13H13NO4S and a molecular weight of 279.32 g/mol. Its IUPAC name is [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] furan-2-carboxylate.
| Compound Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 651235 |
| Molecular Formula | C13H13NO4S |
| Molecular Weight | 279.32 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] furan-2-carboxylate |
| SMILES | CC(OC(=O)c1ccco1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C13H13NO4S/c1-9(18-13(16)11-5-2-6-17-11)12(15)14-8-10-4-3-7-19-10/h2-7,9H,8H2,1H3,(H,14,15) |
| InChIKey | CRNWUJFVGQNUKL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.32 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |