C17H15N3O3S — CID 30978765
[(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] quinoxaline-6-carboxylate (PubChem CID 30978765) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] quinoxaline-6-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] quinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 30978765 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] quinoxaline-6-carboxylate |
| SMILES | C[C@@H](OC(=O)c1ccc2nccnc2c1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C17H15N3O3S/c1-11(16(21)20-10-13-3-2-8-24-13)23-17(22)12-4-5-14-15(9-12)19-7-6-18-14/h2-9,11H,10H2,1H3,(H,20,21)/t11-/m1/s1 |
| InChIKey | CJAFUMOEUDMUFU-LLVKDONJSA-N |
| XLogP | 2.55 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |