C18H21NO5S — CID 8985463
[(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-ethoxy-4-methoxybenzoate (PubChem CID 8985463) has the molecular formula C18H21NO5S and a molecular weight of 363.44 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-ethoxy-4-methoxybenzoate.
| Compound Name | [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-ethoxy-4-methoxybenzoate |
|---|---|
| PubChem CID | 8985463 |
| Molecular Formula | C18H21NO5S |
| Molecular Weight | 363.44 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | [(2R)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 3-ethoxy-4-methoxybenzoate |
| SMILES | CCOc1cc(C(=O)O[C@H](C)C(=O)NCc2cccs2)ccc1OC |
| InChI | InChI=1S/C18H21NO5S/c1-4-23-16-10-13(7-8-15(16)22-3)18(21)24-12(2)17(20)19-11-14-6-5-9-25-14/h5-10,12H,4,11H2,1-3H3,(H,19,20)/t12-/m1/s1 |
| InChIKey | BHAKWYDFANPHAY-GFCCVEGCSA-N |
| XLogP | 3.02 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.44 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |