C20H19NO4S — CID 9003153
[(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 4-methoxynaphthalene-1-carboxylate (PubChem CID 9003153) has the molecular formula C20H19NO4S and a molecular weight of 369.44 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 4-methoxynaphthalene-1-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 4-methoxynaphthalene-1-carboxylate |
|---|---|
| PubChem CID | 9003153 |
| Molecular Formula | C20H19NO4S |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | [(2S)-1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 4-methoxynaphthalene-1-carboxylate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)NCc2cccs2)c2ccccc12 |
| InChI | InChI=1S/C20H19NO4S/c1-13(19(22)21-12-14-6-5-11-26-14)25-20(23)17-9-10-18(24-2)16-8-4-3-7-15(16)17/h3-11,13H,12H2,1-2H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | BEYYBKYPKUNGPM-ZDUSSCGKSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |