C20H20N2O4S — CID 18091294
[1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 18091294) has the molecular formula C20H20N2O4S and a molecular weight of 384.46 g/mol. Its IUPAC name is [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 18091294 |
| Molecular Formula | C20H20N2O4S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [1-oxo-1-(thiophen-2-ylmethylamino)propan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NCc1ccco1)C(=O)NCc1cccs1 |
| InChI | InChI=1S/C20H20N2O4S/c1-14(19(23)22-13-16-7-5-11-27-16)26-20(24)17-8-2-3-9-18(17)21-12-15-6-4-10-25-15/h2-11,14,21H,12-13H2,1H3,(H,22,23) |
| InChIKey | ZSVKVAYNOGCQDS-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |