C25H30N2O4 — CID 7149969
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 7149969) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 7149969 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1NCc1ccco1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H30N2O4/c1-16(23(28)27-25-12-17-9-18(13-25)11-19(10-17)14-25)31-24(29)21-6-2-3-7-22(21)26-15-20-5-4-8-30-20/h2-8,16-19,26H,9-15H2,1H3,(H,27,28)/t16-,17?,18?,19?,25?/m0/s1 |
| InChIKey | RNMHOTOPKLXZEV-DUXBZUBYSA-N |
| XLogP | 4.52 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |