C27H30F2N2O3S — CID 4319750
[1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate (PubChem CID 4319750) has the molecular formula C27H30F2N2O3S and a molecular weight of 500.61 g/mol. Its IUPAC name is [1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate.
| Compound Name | [1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
|---|---|
| PubChem CID | 4319750 |
| Molecular Formula | C27H30F2N2O3S |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | [1-(1-adamantylamino)-1-oxopropan-2-yl] 2-[4-(difluoromethylsulfanyl)anilino]benzoate |
| SMILES | CC(OC(=O)c1ccccc1Nc1ccc(SC(F)F)cc1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H30F2N2O3S/c1-16(24(32)31-27-13-17-10-18(14-27)12-19(11-17)15-27)34-25(33)22-4-2-3-5-23(22)30-20-6-8-21(9-7-20)35-26(28)29/h2-9,16-19,26,30H,10-15H2,1H3,(H,31,32) |
| InChIKey | PSXCMQMXEPZRLG-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |