C22H22N2O5 — CID 2635169
[(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 2635169) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 2635169 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | [(2S)-1-(2-methoxyanilino)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | COc1ccccc1NC(=O)[C@H](C)OC(=O)c1ccccc1NCc1ccco1 |
| InChI | InChI=1S/C22H22N2O5/c1-15(21(25)24-19-11-5-6-12-20(19)27-2)29-22(26)17-9-3-4-10-18(17)23-14-16-8-7-13-28-16/h3-13,15,23H,14H2,1-2H3,(H,24,25)/t15-/m0/s1 |
| InChIKey | IKRFGGZNMRGCNW-HNNXBMFYSA-N |
| XLogP | 4.08 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |