C21H18BrNO4 — CID 18209067
[1-(4-bromophenyl)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate (PubChem CID 18209067) has the molecular formula C21H18BrNO4 and a molecular weight of 428.28 g/mol. Its IUPAC name is [1-(4-bromophenyl)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate.
| Compound Name | [1-(4-bromophenyl)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 18209067 |
| Molecular Formula | C21H18BrNO4 |
| Molecular Weight | 428.28 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | [1-(4-bromophenyl)-1-oxopropan-2-yl] 2-(furan-2-ylmethylamino)benzoate |
| SMILES | CC(OC(=O)c1ccccc1NCc1ccco1)C(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C21H18BrNO4/c1-14(20(24)15-8-10-16(22)11-9-15)27-21(25)18-6-2-3-7-19(18)23-13-17-5-4-12-26-17/h2-12,14,23H,13H2,1H3 |
| InChIKey | RUVMJTHAHZKNQD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.28 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |