C18H14FNO4S — CID 648857
[1-(4-fluorophenyl)-2-oxo-2-(thiophen-2-ylmethylamino)ethyl] furan-2-carboxylate (PubChem CID 648857) has the molecular formula C18H14FNO4S and a molecular weight of 359.38 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-2-oxo-2-(thiophen-2-ylmethylamino)ethyl] furan-2-carboxylate.
| Compound Name | [1-(4-fluorophenyl)-2-oxo-2-(thiophen-2-ylmethylamino)ethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 648857 |
| Molecular Formula | C18H14FNO4S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | [1-(4-fluorophenyl)-2-oxo-2-(thiophen-2-ylmethylamino)ethyl] furan-2-carboxylate |
| SMILES | O=C(OC(C(=O)NCc1cccs1)c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C18H14FNO4S/c19-13-7-5-12(6-8-13)16(24-18(22)15-4-1-9-23-15)17(21)20-11-14-3-2-10-25-14/h1-10,16H,11H2,(H,20,21) |
| InChIKey | GEBHVYOUUKPLHS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |