C18H18FNO5 — CID 1470209
[(1S)-1-(4-fluorophenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] furan-2-carboxylate (PubChem CID 1470209) has the molecular formula C18H18FNO5 and a molecular weight of 347.34 g/mol. Its IUPAC name is [(1S)-1-(4-fluorophenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] furan-2-carboxylate.
| Compound Name | [(1S)-1-(4-fluorophenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 1470209 |
| Molecular Formula | C18H18FNO5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | [(1S)-1-(4-fluorophenyl)-2-oxo-2-[[(2R)-oxolan-2-yl]methylamino]ethyl] furan-2-carboxylate |
| SMILES | O=C(O[C@H](C(=O)NC[C@H]1CCCO1)c1ccc(F)cc1)c1ccco1 |
| InChI | InChI=1S/C18H18FNO5/c19-13-7-5-12(6-8-13)16(25-18(22)15-4-2-10-24-15)17(21)20-11-14-3-1-9-23-14/h2,4-8,10,14,16H,1,3,9,11H2,(H,20,21)/t14-,16+/m1/s1 |
| InChIKey | ZSDLMFKBVPKZGX-ZBFHGGJFSA-N |
| XLogP | 2.61 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |