C23H24FNO5 — CID 16599980
[2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate (PubChem CID 16599980) has the molecular formula C23H24FNO5 and a molecular weight of 413.45 g/mol. Its IUPAC name is [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate.
| Compound Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
|---|---|
| PubChem CID | 16599980 |
| Molecular Formula | C23H24FNO5 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [2-(cyclopropylamino)-1-(4-fluorophenyl)-2-oxoethyl] 4-(oxolan-2-ylmethoxy)benzoate |
| SMILES | O=C(OC(C(=O)NC1CC1)c1ccc(F)cc1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H24FNO5/c24-17-7-3-15(4-8-17)21(22(26)25-18-9-10-18)30-23(27)16-5-11-19(12-6-16)29-14-20-2-1-13-28-20/h3-8,11-12,18,20-21H,1-2,9-10,13-14H2,(H,25,26) |
| InChIKey | IECGOBRMIJBUMM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |