C24H27NO6 — CID 7705762
[(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate (PubChem CID 7705762) has the molecular formula C24H27NO6 and a molecular weight of 425.48 g/mol. Its IUPAC name is [(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate.
| Compound Name | [(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
|---|---|
| PubChem CID | 7705762 |
| Molecular Formula | C24H27NO6 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | [(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 4-[[(2R)-oxolan-2-yl]methoxy]benzoate |
| SMILES | O=C(O[C@@H](C(=O)N1CCOCC1)c1ccccc1)c1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H27NO6/c26-23(25-12-15-28-16-13-25)22(18-5-2-1-3-6-18)31-24(27)19-8-10-20(11-9-19)30-17-21-7-4-14-29-21/h1-3,5-6,8-11,21-22H,4,7,12-17H2/t21-,22-/m1/s1 |
| InChIKey | ASHBZSSQAFIDMQ-FGZHOGPDSA-N |
| XLogP | 3.00 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |