C23H23NO4 — CID 134029356
N-[furan-2-yl(phenyl)methyl]-4-(oxolan-2-ylmethoxy)benzamide (PubChem CID 134029356) has the molecular formula C23H23NO4 and a molecular weight of 377.44 g/mol. Its IUPAC name is N-[furan-2-yl(phenyl)methyl]-4-(oxolan-2-ylmethoxy)benzamide.
| Compound Name | N-[furan-2-yl(phenyl)methyl]-4-(oxolan-2-ylmethoxy)benzamide |
|---|---|
| PubChem CID | 134029356 |
| Molecular Formula | C23H23NO4 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | N-[furan-2-yl(phenyl)methyl]-4-(oxolan-2-ylmethoxy)benzamide |
| SMILES | O=C(NC(c1ccccc1)c1ccco1)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C23H23NO4/c25-23(18-10-12-19(13-11-18)28-16-20-8-4-14-26-20)24-22(21-9-5-15-27-21)17-6-2-1-3-7-17/h1-3,5-7,9-13,15,20,22H,4,8,14,16H2,(H,24,25) |
| InChIKey | DLUDULBZGPDCPD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |