C19H20N2O5 — CID 43016979
2-hydroxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide (PubChem CID 43016979) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-hydroxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide.
| Compound Name | 2-hydroxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide |
|---|---|
| PubChem CID | 43016979 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 2-hydroxy-N'-[4-(oxolan-2-ylmethoxy)benzoyl]benzohydrazide |
| SMILES | O=C(NNC(=O)c1ccccc1O)c1ccc(OCC2CCCO2)cc1 |
| InChI | InChI=1S/C19H20N2O5/c22-17-6-2-1-5-16(17)19(24)21-20-18(23)13-7-9-14(10-8-13)26-12-15-4-3-11-25-15/h1-2,5-10,15,22H,3-4,11-12H2,(H,20,23)(H,21,24) |
| InChIKey | QJYKRRPVWHSDON-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|