C22H25NO6 — CID 7704937
[(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(4-ethoxyphenoxy)acetate (PubChem CID 7704937) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is [(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(4-ethoxyphenoxy)acetate.
| Compound Name | [(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(4-ethoxyphenoxy)acetate |
|---|---|
| PubChem CID | 7704937 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | [(1S)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(4-ethoxyphenoxy)acetate |
| SMILES | CCOc1ccc(OCC(=O)O[C@H](C(=O)N2CCOCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H25NO6/c1-2-27-18-8-10-19(11-9-18)28-16-20(24)29-21(17-6-4-3-5-7-17)22(25)23-12-14-26-15-13-23/h3-11,21H,2,12-16H2,1H3/t21-/m0/s1 |
| InChIKey | XRWANFPECRWPQX-NRFANRHFSA-N |
| XLogP | 2.61 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |