C20H19ClFNO5 — CID 8639042
[(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(2-chloro-4-fluorophenoxy)acetate (PubChem CID 8639042) has the molecular formula C20H19ClFNO5 and a molecular weight of 407.83 g/mol. Its IUPAC name is [(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(2-chloro-4-fluorophenoxy)acetate.
| Compound Name | [(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(2-chloro-4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 8639042 |
| Molecular Formula | C20H19ClFNO5 |
| Molecular Weight | 407.83 g/mol |
| Exact Mass | 407.09 |
| IUPAC Name | [(1R)-2-morpholin-4-yl-2-oxo-1-phenylethyl] 2-(2-chloro-4-fluorophenoxy)acetate |
| SMILES | O=C(COc1ccc(F)cc1Cl)O[C@@H](C(=O)N1CCOCC1)c1ccccc1 |
| InChI | InChI=1S/C20H19ClFNO5/c21-16-12-15(22)6-7-17(16)27-13-18(24)28-19(14-4-2-1-3-5-14)20(25)23-8-10-26-11-9-23/h1-7,12,19H,8-11,13H2/t19-/m1/s1 |
| InChIKey | ACPCTLGRSSDPND-LJQANCHMSA-N |
| XLogP | 3.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.83 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |