C19H17Cl2NO4 — CID 18198853
(2-morpholin-4-yl-2-oxo-1-phenylethyl) 2,6-dichlorobenzoate (PubChem CID 18198853) has the molecular formula C19H17Cl2NO4 and a molecular weight of 394.25 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxo-1-phenylethyl) 2,6-dichlorobenzoate.
| Compound Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 2,6-dichlorobenzoate |
|---|---|
| PubChem CID | 18198853 |
| Molecular Formula | C19H17Cl2NO4 |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 393.05 |
| IUPAC Name | (2-morpholin-4-yl-2-oxo-1-phenylethyl) 2,6-dichlorobenzoate |
| SMILES | O=C(OC(C(=O)N1CCOCC1)c1ccccc1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H17Cl2NO4/c20-14-7-4-8-15(21)16(14)19(24)26-17(13-5-2-1-3-6-13)18(23)22-9-11-25-12-10-22/h1-8,17H,9-12H2 |
| InChIKey | OXRACHYADBFIQT-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |